C45H55ClN10O7S — CID 178083739
CID 178083739 (PubChem CID 178083739) has the molecular formula C45H55ClN10O7S and a molecular weight of 915.52 g/mol.
| Compound Name | CID 178083739 |
|---|---|
| PubChem CID | 178083739 |
| Molecular Formula | C45H55ClN10O7S |
| Molecular Weight | 915.52 g/mol |
| Exact Mass | 914.37 |
| IUPAC Name | — |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCOCCNc2cc(Nc3cc(Cl)c4n(c3=O)C3(CCC5(CC5)CC3)NC4=O)ncn2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C45H55ClN10O7S/c1-26-37(64-25-51-26)28-7-5-27(6-8-28)22-48-39(59)32-19-29(57)23-55(32)42(62)38(43(2,3)4)53-35(58)9-17-63-18-16-47-33-21-34(50-24-49-33)52-31-20-30(46)36-40(60)54-45(56(36)41(31)61)14-12-44(10-11-44)13-15-45/h5-8,20-21,24-25,29,32,38,57H,9-19,22-23H2,1-4H3,(H,48,59)(H,53,58)(H,54,60)(H2,47,49,50,52)/t29-,32?,38-/m1/s1 |
| InChIKey | AQQFCIFLXHCWJW-CJUORTIWSA-N |
| XLogP | 4.85 |
| TPSA | 221.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|