C52H70N10O9S — CID 178083806
CID 178083806 (PubChem CID 178083806) has the molecular formula C52H70N10O9S and a molecular weight of 1011.26 g/mol.
| Compound Name | CID 178083806 |
|---|---|
| PubChem CID | 178083806 |
| Molecular Formula | C52H70N10O9S |
| Molecular Weight | 1011.26 g/mol |
| Exact Mass | 1010.50 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(NCCOCCOCCOCCOCCC(=O)NC(C(=O)N3CCC[C@H]3C(=O)NCc3ccc(-c4scnc4C)cc3)C(C)(C)C)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC2)CC1 |
| InChI | InChI=1S/C52H70N10O9S/c1-34-29-38(48(66)62-43(34)47(65)60-52(62)17-15-51(13-14-51)16-18-52)58-41-30-40(55-32-56-41)53-19-22-69-24-26-71-28-27-70-25-23-68-21-12-42(63)59-45(50(3,4)5)49(67)61-20-6-7-39(61)46(64)54-31-36-8-10-37(11-9-36)44-35(2)57-33-72-44/h8-11,29-30,32-33,39,45H,6-7,12-28,31H2,1-5H3,(H,54,64)(H,59,63)(H,60,65)(H2,53,55,56,58)/t39-,45?/m0/s1 |
| InChIKey | OCLSAUBBGFRKRZ-PWLYXOBOSA-N |
| XLogP | 5.58 |
| TPSA | 229.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|