C48H64N10O9S — CID 178083714
CID 178083714 (PubChem CID 178083714) has the molecular formula C48H64N10O9S and a molecular weight of 957.17 g/mol.
| Compound Name | CID 178083714 |
|---|---|
| PubChem CID | 178083714 |
| Molecular Formula | C48H64N10O9S |
| Molecular Weight | 957.17 g/mol |
| Exact Mass | 956.46 |
| IUPAC Name | — |
| SMILES | CC(C)C.Cc1cc(Nc2cc(NC(=O)COCCOCCC(=O)NCC(=O)N3CCC(O)C3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC2)CC1.Cc1ncsc1-c1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C32H42N8O8.C12H12N2OS.C4H10/c1-20-14-22(30(46)40-28(20)29(45)38-32(40)8-6-31(4-5-31)7-9-32)36-23-15-24(35-19-34-23)37-26(43)18-48-13-12-47-11-3-25(42)33-16-27(44)39-10-2-21(41)17-39;1-9-12(16-8-14-9)11-4-2-10(3-5-11)6-13-7-15;1-4(2)3/h14-15,19,21,41H,2-13,16-18H2,1H3,(H,33,42)(H,38,45)(H2,34,35,36,37,43);2-5,7-8H,6H2,1H3,(H,13,15);4H,1-3H3 |
| InChIKey | GUWKLNBZWLNEIK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 248.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.17 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|