C48H64N10O6S — CID 178083717
CID 178083717 (PubChem CID 178083717) has the molecular formula C48H64N10O6S and a molecular weight of 909.17 g/mol.
| Compound Name | CID 178083717 |
|---|---|
| PubChem CID | 178083717 |
| Molecular Formula | C48H64N10O6S |
| Molecular Weight | 909.17 g/mol |
| Exact Mass | 908.47 |
| IUPAC Name | — |
| SMILES | CCCC(C)(C)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NCc1ccc(-c2scnc2C)cc1)C(C)(C)C.Nc1cc(Nc2cc(CO)c3n(c2=O)C2(CCC4(CC4)CC2)NC3=O)ncn1 |
| InChI | InChI=1S/C29H42N4O3S.C19H22N6O3/c1-8-15-29(6,7)27(36)32-24(28(3,4)5)26(35)33-16-9-10-22(33)25(34)30-17-20-11-13-21(14-12-20)23-19(2)31-18-37-23;20-13-8-14(22-10-21-13)23-12-7-11(9-26)15-16(27)24-19(25(15)17(12)28)5-3-18(1-2-18)4-6-19/h11-14,18,22,24H,8-10,15-17H2,1-7H3,(H,30,34)(H,32,36);7-8,10,26H,1-6,9H2,(H,24,27)(H3,20,21,22,23)/t22-,24+;/m0./s1 |
| InChIKey | WRZOZYQAVDWGCQ-ROOQTRKKSA-N |
| XLogP | 6.29 |
| TPSA | 226.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.17 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |