About N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide
N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide (PubChem CID 178084428) has the molecular formula C7H10BrN3O
and a molecular weight of 232.08 g/mol. Its IUPAC name is N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide |
| PubChem CID | 178084428 |
| Molecular Formula | C7H10BrN3O |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide |
| SMILES | CC(=O)Nc1nn(C)c(Br)c1C |
| InChI | InChI=1S/C7H10BrN3O/c1-4-6(8)11(3)10-7(4)9-5(2)12/h1-3H3,(H,9,10,12) |
| InChIKey | NFMGHAXJQYCQLW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide?
The IUPAC name of N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide (CID 178084428) is N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide.
What is the SMILES notation for N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide?
The canonical SMILES for N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide is CC(=O)Nc1nn(C)c(Br)c1C.
What is the InChIKey of N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide?
The InChIKey is NFMGHAXJQYCQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN3O/c1-4-6(8)11(3)10-7(4)9-5(2)12/h1-3H3,(H,9,10,12).
What are the key properties of N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide?
N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide has a molecular weight of 232.08 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-1,4-dimethylpyrazol-3-yl)acetamide is sourced from PubChem (CID 178084428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).