C19H33F2NO3 — CID 178086973
tert-butyl (2S)-2-[(2R)-2-[difluoro(oxan-4-yl)methyl]pyrrolidin-1-yl]-3-methylbutanoate (PubChem CID 178086973) has the molecular formula C19H33F2NO3 and a molecular weight of 361.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-2-[difluoro(oxan-4-yl)methyl]pyrrolidin-1-yl]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(2R)-2-[difluoro(oxan-4-yl)methyl]pyrrolidin-1-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 178086973 |
| Molecular Formula | C19H33F2NO3 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-2-[difluoro(oxan-4-yl)methyl]pyrrolidin-1-yl]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)N1CCC[C@@H]1C(F)(F)C1CCOCC1 |
| InChI | InChI=1S/C19H33F2NO3/c1-13(2)16(17(23)25-18(3,4)5)22-10-6-7-15(22)19(20,21)14-8-11-24-12-9-14/h13-16H,6-12H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | SSVNGJDWIWZMMR-CVEARBPZSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |