C19H31NO4 — CID 178087108
tert-butyl (2S)-2-[(2S)-2-[2-(3-methoxyoxetan-3-yl)ethynyl]pyrrolidin-1-yl]-3-methylbutanoate (PubChem CID 178087108) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2S)-2-[2-(3-methoxyoxetan-3-yl)ethynyl]pyrrolidin-1-yl]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(2S)-2-[2-(3-methoxyoxetan-3-yl)ethynyl]pyrrolidin-1-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 178087108 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl (2S)-2-[(2S)-2-[2-(3-methoxyoxetan-3-yl)ethynyl]pyrrolidin-1-yl]-3-methylbutanoate |
| SMILES | COC1(C#C[C@@H]2CCCN2[C@H](C(=O)OC(C)(C)C)C(C)C)COC1 |
| InChI | InChI=1S/C19H31NO4/c1-14(2)16(17(21)24-18(3,4)5)20-11-7-8-15(20)9-10-19(22-6)12-23-13-19/h14-16H,7-8,11-13H2,1-6H3/t15-,16-/m0/s1 |
| InChIKey | MASWXKLWQAIUIC-HOTGVXAUSA-N |
| XLogP | 2.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|