C26H30N6 — CID 178087477
(13Z,16E)-N,10,16-trimethyl-2,10,19,27,28-pentazatetracyclo[18.7.1.04,9.021,26]octacosa-1(27),4,6,8,13,16,20(28),21,23,25-decaen-18-imine (PubChem CID 178087477) has the molecular formula C26H30N6 and a molecular weight of 426.57 g/mol. Its IUPAC name is (13Z,16E)-N,10,16-trimethyl-2,10,19,27,28-pentazatetracyclo[18.7.1.04,9.021,26]octacosa-1(27),4,6,8,13,16,20(28),21,23,25-decaen-18-imine.
| Compound Name | (13Z,16E)-N,10,16-trimethyl-2,10,19,27,28-pentazatetracyclo[18.7.1.04,9.021,26]octacosa-1(27),4,6,8,13,16,20(28),21,23,25-decaen-18-imine |
|---|---|
| PubChem CID | 178087477 |
| Molecular Formula | C26H30N6 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (13Z,16E)-N,10,16-trimethyl-2,10,19,27,28-pentazatetracyclo[18.7.1.04,9.021,26]octacosa-1(27),4,6,8,13,16,20(28),21,23,25-decaen-18-imine |
| SMILES | C/N=C1/C=C(\C)C/C=C\CCN(C)c2ccccc2CNc2nc(c3ccccc3n2)N1 |
| InChI | InChI=1S/C26H30N6/c1-19-11-5-4-10-16-32(3)23-15-9-6-12-20(23)18-28-26-29-22-14-8-7-13-21(22)25(31-26)30-24(17-19)27-2/h4-9,12-15,17H,10-11,16,18H2,1-3H3,(H2,27,28,29,30,31)/b5-4-,19-17+ |
| InChIKey | VRKPOVCBVCJXGC-AXYPRBLOSA-N |
| XLogP | 5.41 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|