C24H24N6 — CID 178087557
(8Z)-2,4,5,20,22,29-hexazapentacyclo[19.7.1.13,6.013,18.023,28]triaconta-1(29),3,6(30),8,13,15,17,21,23,25,27-undecaene (PubChem CID 178087557) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is (8Z)-2,4,5,20,22,29-hexazapentacyclo[19.7.1.13,6.013,18.023,28]triaconta-1(29),3,6(30),8,13,15,17,21,23,25,27-undecaene.
| Compound Name | (8Z)-2,4,5,20,22,29-hexazapentacyclo[19.7.1.13,6.013,18.023,28]triaconta-1(29),3,6(30),8,13,15,17,21,23,25,27-undecaene |
|---|---|
| PubChem CID | 178087557 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (8Z)-2,4,5,20,22,29-hexazapentacyclo[19.7.1.13,6.013,18.023,28]triaconta-1(29),3,6(30),8,13,15,17,21,23,25,27-undecaene |
| SMILES | C1=C\Cc2cc(n[nH]2)Nc2nc(nc3ccccc23)NCc2ccccc2CCC/1 |
| InChI | InChI=1S/C24H24N6/c1-2-4-12-19-15-22(30-29-19)27-23-20-13-7-8-14-21(20)26-24(28-23)25-16-18-11-6-5-10-17(18)9-3-1/h2,4-8,10-11,13-15H,1,3,9,12,16H2,(H3,25,26,27,28,29,30)/b4-2- |
| InChIKey | XWCBZDOIEPHCBO-RQOWECAXSA-N |
| XLogP | 5.14 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|