C30H35F3N2O9 — CID 178088773
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[4-[(3R,4R)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)oxy]-1-(2,2,2-trifluoroethyl)piperidin-3-yl]phenyl]methoxy]oxane-2-carboxylic acid (PubChem CID 178088773) has the molecular formula C30H35F3N2O9 and a molecular weight of 624.61 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[4-[(3R,4R)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)oxy]-1-(2,2,2-trifluoroethyl)piperidin-3-yl]phenyl]methoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[4-[(3R,4R)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)oxy]-1-(2,2,2-trifluoroethyl)piperidin-3-yl]phenyl]methoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 178088773 |
| Molecular Formula | C30H35F3N2O9 |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[4-[(3R,4R)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)oxy]-1-(2,2,2-trifluoroethyl)piperidin-3-yl]phenyl]methoxy]oxane-2-carboxylic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1O[C@@H]1CCN(CC(F)(F)F)C[C@H]1c1ccc(CO[C@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H35F3N2O9/c1-15-11-21(41-2)26(18-7-9-34-22(15)18)43-20-8-10-35(14-30(31,32)33)12-19(20)17-5-3-16(4-6-17)13-42-29-25(38)23(36)24(37)27(44-29)28(39)40/h3-7,9,11,19-20,23-25,27,29,34,36-38H,8,10,12-14H2,1-2H3,(H,39,40)/t19-,20+,23-,24-,25+,27-,29-/m0/s1 |
| InChIKey | WYQJSKPQQHWXCL-LMVKZDAKSA-N |
| XLogP | 2.69 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |