C20H22ClN4O+ — CID 178088841
4-(6-chloro-1-methyl-2,3-didehydro-4H-pyridazin-2-ium-5-yl)-N-pentylquinoline-2-carboxamide (PubChem CID 178088841) has the molecular formula C20H22ClN4O+ and a molecular weight of 369.88 g/mol. Its IUPAC name is 4-(6-chloro-1-methyl-2,3-didehydro-4H-pyridazin-2-ium-5-yl)-N-pentylquinoline-2-carboxamide.
| Compound Name | 4-(6-chloro-1-methyl-2,3-didehydro-4H-pyridazin-2-ium-5-yl)-N-pentylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 178088841 |
| Molecular Formula | C20H22ClN4O+ |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-(6-chloro-1-methyl-2,3-didehydro-4H-pyridazin-2-ium-5-yl)-N-pentylquinoline-2-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(C2=C(Cl)N(C)[N+]#CC2)c2ccccc2n1 |
| InChI | InChI=1S/C20H21ClN4O/c1-3-4-7-11-22-20(26)18-13-16(14-8-5-6-9-17(14)24-18)15-10-12-23-25(2)19(15)21/h5-6,8-9,13H,3-4,7,10-11H2,1-2H3/p+1 |
| InChIKey | DKQROAUHOIUJSN-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 49.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|