C22H32N4O2 — CID 124737653
4-(dimethylamino)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]quinoline-2-carboxamide (PubChem CID 124737653) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]quinoline-2-carboxamide.
| Compound Name | 4-(dimethylamino)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 124737653 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 4-(dimethylamino)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]quinoline-2-carboxamide |
| SMILES | C[C@H]1CN(CCCCNC(=O)c2cc(N(C)C)c3ccccc3n2)C[C@H](C)O1 |
| InChI | InChI=1S/C22H32N4O2/c1-16-14-26(15-17(2)28-16)12-8-7-11-23-22(27)20-13-21(25(3)4)18-9-5-6-10-19(18)24-20/h5-6,9-10,13,16-17H,7-8,11-12,14-15H2,1-4H3,(H,23,27)/t16-,17-/m0/s1 |
| InChIKey | PXNHVQLROSGRQR-IRXDYDNUSA-N |
| XLogP | 2.92 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|