C20H24BrN5Si — CID 178089518
N-[(6-bromo-3-pyridinyl)methyl]-4-(4,4-dimethyl-1,4-azasilinan-1-yl)quinazolin-2-amine (PubChem CID 178089518) has the molecular formula C20H24BrN5Si and a molecular weight of 442.44 g/mol. Its IUPAC name is N-[(6-bromo-3-pyridinyl)methyl]-4-(4,4-dimethyl-1,4-azasilinan-1-yl)quinazolin-2-amine.
| Compound Name | N-[(6-bromo-3-pyridinyl)methyl]-4-(4,4-dimethyl-1,4-azasilinan-1-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 178089518 |
| Molecular Formula | C20H24BrN5Si |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-[(6-bromo-3-pyridinyl)methyl]-4-(4,4-dimethyl-1,4-azasilinan-1-yl)quinazolin-2-amine |
| SMILES | C[Si]1(C)CCN(c2nc(NCc3ccc(Br)nc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H24BrN5Si/c1-27(2)11-9-26(10-12-27)19-16-5-3-4-6-17(16)24-20(25-19)23-14-15-7-8-18(21)22-13-15/h3-8,13H,9-12,14H2,1-2H3,(H,23,24,25) |
| InChIKey | NZYLKHROAKLNOS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|