C20H21F4N5 — CID 178089561
ethane;N-[(6-fluoro-3-pyridinyl)methyl]-4-[3-(trifluoromethyl)azetidin-1-yl]quinazolin-2-amine (PubChem CID 178089561) has the molecular formula C20H21F4N5 and a molecular weight of 407.42 g/mol. Its IUPAC name is ethane;N-[(6-fluoro-3-pyridinyl)methyl]-4-[3-(trifluoromethyl)azetidin-1-yl]quinazolin-2-amine.
| Compound Name | ethane;N-[(6-fluoro-3-pyridinyl)methyl]-4-[3-(trifluoromethyl)azetidin-1-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 178089561 |
| Molecular Formula | C20H21F4N5 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethane;N-[(6-fluoro-3-pyridinyl)methyl]-4-[3-(trifluoromethyl)azetidin-1-yl]quinazolin-2-amine |
| SMILES | CC.Fc1ccc(CNc2nc(N3CC(C(F)(F)F)C3)c3ccccc3n2)cn1 |
| InChI | InChI=1S/C18H15F4N5.C2H6/c19-15-6-5-11(7-23-15)8-24-17-25-14-4-2-1-3-13(14)16(26-17)27-9-12(10-27)18(20,21)22;1-2/h1-7,12H,8-10H2,(H,24,25,26);1-2H3 |
| InChIKey | OITWRXCYGXOKSN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|