C20H23F2N5O — CID 178089580
ethane;4-(3-fluoroazetidin-1-yl)-N-[(6-fluoro-3-pyridinyl)methyl]-6-methoxyquinazolin-2-amine (PubChem CID 178089580) has the molecular formula C20H23F2N5O and a molecular weight of 387.43 g/mol. Its IUPAC name is ethane;4-(3-fluoroazetidin-1-yl)-N-[(6-fluoro-3-pyridinyl)methyl]-6-methoxyquinazolin-2-amine.
| Compound Name | ethane;4-(3-fluoroazetidin-1-yl)-N-[(6-fluoro-3-pyridinyl)methyl]-6-methoxyquinazolin-2-amine |
|---|---|
| PubChem CID | 178089580 |
| Molecular Formula | C20H23F2N5O |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | ethane;4-(3-fluoroazetidin-1-yl)-N-[(6-fluoro-3-pyridinyl)methyl]-6-methoxyquinazolin-2-amine |
| SMILES | CC.COc1ccc2nc(NCc3ccc(F)nc3)nc(N3CC(F)C3)c2c1 |
| InChI | InChI=1S/C18H17F2N5O.C2H6/c1-26-13-3-4-15-14(6-13)17(25-9-12(19)10-25)24-18(23-15)22-8-11-2-5-16(20)21-7-11;1-2/h2-7,12H,8-10H2,1H3,(H,22,23,24);1-2H3 |
| InChIKey | PBRYPGIHXRWACN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|