C29H46O4 — CID 178090738
2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(E)-7-methoxyhept-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetic acid (PubChem CID 178090738) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is 2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(E)-7-methoxyhept-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetic acid.
| Compound Name | 2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(E)-7-methoxyhept-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 178090738 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(E)-7-methoxyhept-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetic acid |
| SMILES | COCCCC/C=C(\C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OCC(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H46O4/c1-20(8-6-5-7-17-32-4)24-11-12-25-23-10-9-21-18-22(33-19-27(30)31)13-15-28(21,2)26(23)14-16-29(24,25)3/h8-9,22-26H,5-7,10-19H2,1-4H3,(H,30,31)/b20-8+/t22-,23-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | FPHDRPKIFUYZJN-KVNHPXETSA-N |
| XLogP | 6.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|