C23H48N6O7 — CID 178093292
6-[3-[2-[3-[bis[2-(2-aminoethoxy)ethyl]amino]-3-oxopropoxy]ethoxy]propanoylamino]-2-(methylamino)hexanamide (PubChem CID 178093292) has the molecular formula C23H48N6O7 and a molecular weight of 520.67 g/mol. Its IUPAC name is 6-[3-[2-[3-[bis[2-(2-aminoethoxy)ethyl]amino]-3-oxopropoxy]ethoxy]propanoylamino]-2-(methylamino)hexanamide.
| Compound Name | 6-[3-[2-[3-[bis[2-(2-aminoethoxy)ethyl]amino]-3-oxopropoxy]ethoxy]propanoylamino]-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 178093292 |
| Molecular Formula | C23H48N6O7 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 6-[3-[2-[3-[bis[2-(2-aminoethoxy)ethyl]amino]-3-oxopropoxy]ethoxy]propanoylamino]-2-(methylamino)hexanamide |
| SMILES | CNC(CCCCNC(=O)CCOCCOCCC(=O)N(CCOCCN)CCOCCN)C(N)=O |
| InChI | InChI=1S/C23H48N6O7/c1-27-20(23(26)32)4-2-3-9-28-21(30)5-12-33-18-19-34-13-6-22(31)29(10-16-35-14-7-24)11-17-36-15-8-25/h20,27H,2-19,24-25H2,1H3,(H2,26,32)(H,28,30) |
| InChIKey | ACSIADOLRXNWNL-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 193.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|