C45H72BN15O11Pb — CID 178094239
CID 178094239 (PubChem CID 178094239) has the molecular formula C45H72BN15O11Pb and a molecular weight of 1217.18 g/mol.
| Compound Name | CID 178094239 |
|---|---|
| PubChem CID | 178094239 |
| Molecular Formula | C45H72BN15O11Pb |
| Molecular Weight | 1217.18 g/mol |
| Exact Mass | 1217.54 |
| IUPAC Name | — |
| SMILES | NC(=O)CN1CCN(CC(N)=O)CCN(CC(=O)NC(CCCN=C(N)N)C(=O)NCCCCCNC(=O)c2ccc(C(=O)NCC(=O)N3CC(O)CC3B(O)O)c3ccccc23)CCN(CC(N)=O)CC1.[Pb] |
| InChI | InChI=1S/C45H72BN15O11.Pb/c47-37(63)26-57-15-17-58(27-38(48)64)19-21-60(22-20-59(18-16-57)28-39(49)65)29-40(66)56-35(9-6-14-54-45(50)51)44(70)53-13-5-1-4-12-52-42(68)33-10-11-34(32-8-3-2-7-31(32)33)43(69)55-24-41(67)61-25-30(62)23-36(61)46(71)72;/h2-3,7-8,10-11,30,35-36,62,71-72H,1,4-6,9,12-29H2,(H2,47,63)(H2,48,64)(H2,49,65)(H,52,68)(H,53,70)(H,55,69)(H,56,66)(H4,50,51,54); |
| InChIKey | KMUNDQFMISTSLG-UHFFFAOYSA-N |
| XLogP | -6.61 |
| TPSA | 404.03 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1217.18 |
| LogP ≤ 5 | -6.61 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|