C22H24Cl2N4O3 — CID 178098494
2-(3,5-dichlorophenyl)-1-[(3S)-3-[2-(2-methoxyethoxy)imidazo[4,5-b]pyridin-1-yl]piperidin-1-yl]ethanone (PubChem CID 178098494) has the molecular formula C22H24Cl2N4O3 and a molecular weight of 463.37 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-1-[(3S)-3-[2-(2-methoxyethoxy)imidazo[4,5-b]pyridin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(3,5-dichlorophenyl)-1-[(3S)-3-[2-(2-methoxyethoxy)imidazo[4,5-b]pyridin-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 178098494 |
| Molecular Formula | C22H24Cl2N4O3 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-1-[(3S)-3-[2-(2-methoxyethoxy)imidazo[4,5-b]pyridin-1-yl]piperidin-1-yl]ethanone |
| SMILES | COCCOc1nc2ncccc2n1[C@H]1CCCN(C(=O)Cc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C22H24Cl2N4O3/c1-30-8-9-31-22-26-21-19(5-2-6-25-21)28(22)18-4-3-7-27(14-18)20(29)12-15-10-16(23)13-17(24)11-15/h2,5-6,10-11,13,18H,3-4,7-9,12,14H2,1H3/t18-/m0/s1 |
| InChIKey | OAWAVSDGGKVWAE-SFHVURJKSA-N |
| XLogP | 4.17 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|