C3HCl2N3 — CID 17810
2,4-dichloro-1,3,5-triazine (PubChem CID 17810) has the molecular formula C3HCl2N3 and a molecular weight of 149.97 g/mol. Its IUPAC name is 2,4-dichloro-1,3,5-triazine.
| Compound Name | 2,4-dichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 17810 |
| Molecular Formula | C3HCl2N3 |
| Molecular Weight | 149.97 g/mol |
| Exact Mass | 148.95 |
| IUPAC Name | 2,4-dichloro-1,3,5-triazine |
| SMILES | Clc1ncnc(Cl)n1 |
| InChI | InChI=1S/C3HCl2N3/c4-2-6-1-7-3(5)8-2/h1H |
| InChIKey | OMRXVBREYFZQHU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.97 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |