methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate

C15H21NO4 — CID 178103490

IUPACmethyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate
SMILESCOC(=O)c1ccc(N2CCOC(C)(C)C2OC)cc1
InChIInChI=1S/C15H21NO4/c1-15(2)14(19-4)16(9-10-20-15)12-7-5-11(6-8-12)13(17)18-3/h5-8,14H,9-10H2,1-4H3
InChIKeyZRRRJEQOSGHUPD-UHFFFAOYSA-N
MW279.34 g/mol
LogP2.06
Rot. Bonds3

About methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate

methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate (PubChem CID 178103490) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate
PubChem CID178103490
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Namemethyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate
SMILESCOC(=O)c1ccc(N2CCOC(C)(C)C2OC)cc1
InChIInChI=1S/C15H21NO4/c1-15(2)14(19-4)16(9-10-20-15)12-7-5-11(6-8-12)13(17)18-3/h5-8,14H,9-10H2,1-4H3
InChIKeyZRRRJEQOSGHUPD-UHFFFAOYSA-N
XLogP2.06
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 52.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate?
The IUPAC name of methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate (CID 178103490) is methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate.
What is the SMILES notation for methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate?
The canonical SMILES for methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate is COC(=O)c1ccc(N2CCOC(C)(C)C2OC)cc1.
What is the InChIKey of methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate?
The InChIKey is ZRRRJEQOSGHUPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-15(2)14(19-4)16(9-10-20-15)12-7-5-11(6-8-12)13(17)18-3/h5-8,14H,9-10H2,1-4H3.
What are the key properties of methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate?
methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate has a molecular weight of 279.34 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-methoxy-2,2-dimethylmorpholin-4-yl)benzoate is sourced from PubChem (CID 178103490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).