C12H15N6O2Re- — CID 178104743
15-amino-4-methyl-9-oxa-2,11,14,16-tetraza-12-azanidatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraen-4-ol;rhenium (PubChem CID 178104743) has the molecular formula C12H15N6O2Re- and a molecular weight of 461.50 g/mol. Its IUPAC name is 15-amino-4-methyl-9-oxa-2,11,14,16-tetraza-12-azanidatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraen-4-ol;rhenium.
| Compound Name | 15-amino-4-methyl-9-oxa-2,11,14,16-tetraza-12-azanidatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraen-4-ol;rhenium |
|---|---|
| PubChem CID | 178104743 |
| Molecular Formula | C12H15N6O2Re- |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 15-amino-4-methyl-9-oxa-2,11,14,16-tetraza-12-azanidatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraen-4-ol;rhenium |
| SMILES | CC1(O)CCC2COc3n[n-]c4nc(N)nc(c34)N2C1.[Re] |
| InChI | InChI=1S/C12H15N6O2.Re/c1-12(19)3-2-6-4-20-10-7-8(16-17-10)14-11(13)15-9(7)18(6)5-12;/h6,19H,2-5H2,1H3,(H2-,13,14,15,16,17);/q-1; |
| InChIKey | CIHATTZCRLEFPP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |