C15H23N5O — CID 178044441
4,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene;ethane (PubChem CID 178044441) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 4,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene;ethane.
| Compound Name | 4,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene;ethane |
|---|---|
| PubChem CID | 178044441 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 4,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene;ethane |
| SMILES | CC.Cc1nc2c3c(n[nH]c3n1)OCC1CCC(C)CN21 |
| InChI | InChI=1S/C13H17N5O.C2H6/c1-7-3-4-9-6-19-13-10-11(16-17-13)14-8(2)15-12(10)18(9)5-7;1-2/h7,9H,3-6H2,1-2H3,(H,14,15,16,17);1-2H3 |
| InChIKey | LAMKWGSFVWYQIE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |