C14H24N6O2 — CID 178104908
ethane;9-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine;oxolane (PubChem CID 178104908) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is ethane;9-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine;oxolane.
| Compound Name | ethane;9-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine;oxolane |
|---|---|
| PubChem CID | 178104908 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | ethane;9-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine;oxolane |
| SMILES | C1CCOC1.CC.CN1CCOc2n[nH]c3nc(N)nc1c23 |
| InChI | InChI=1S/C8H10N6O.C4H8O.C2H6/c1-14-2-3-15-7-4-5(12-13-7)10-8(9)11-6(4)14;1-2-4-5-3-1;1-2/h2-3H2,1H3,(H3,9,10,11,12,13);1-4H2;1-2H3 |
| InChIKey | VIEKDCPDAWJZJE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |