C10H10F2N5ORe- — CID 178104823
10-(difluoromethyl)-6,9-dimethyl-12-oxa-2,5,7,9-tetraza-3-azanidatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene;rhenium (PubChem CID 178104823) has the molecular formula C10H10F2N5ORe- and a molecular weight of 440.43 g/mol. Its IUPAC name is 10-(difluoromethyl)-6,9-dimethyl-12-oxa-2,5,7,9-tetraza-3-azanidatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene;rhenium.
| Compound Name | 10-(difluoromethyl)-6,9-dimethyl-12-oxa-2,5,7,9-tetraza-3-azanidatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene;rhenium |
|---|---|
| PubChem CID | 178104823 |
| Molecular Formula | C10H10F2N5ORe- |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 10-(difluoromethyl)-6,9-dimethyl-12-oxa-2,5,7,9-tetraza-3-azanidatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene;rhenium |
| SMILES | Cc1nc2c3c(n[n-]c3n1)OCC(C(F)F)N2C.[Re] |
| InChI | InChI=1S/C10H10F2N5O.Re/c1-4-13-8-6-9(14-4)17(2)5(7(11)12)3-18-10(6)16-15-8;/h5,7H,3H2,1-2H3;/q-1; |
| InChIKey | ZURKVNZOKSBGEG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |