C14H19N5O2 — CID 178104795
(10R)-6,10-dimethyl-9-[(3R,5S)-5-methyloxolan-3-yl]-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene (PubChem CID 178104795) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is (10R)-6,10-dimethyl-9-[(3R,5S)-5-methyloxolan-3-yl]-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene.
| Compound Name | (10R)-6,10-dimethyl-9-[(3R,5S)-5-methyloxolan-3-yl]-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
|---|---|
| PubChem CID | 178104795 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (10R)-6,10-dimethyl-9-[(3R,5S)-5-methyloxolan-3-yl]-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
| SMILES | Cc1nc2c3c(n[nH]c3n1)OC[C@@H](C)N2[C@H]1CO[C@@H](C)C1 |
| InChI | InChI=1S/C14H19N5O2/c1-7-5-21-14-11-12(17-18-14)15-9(3)16-13(11)19(7)10-4-8(2)20-6-10/h7-8,10H,4-6H2,1-3H3,(H,15,16,17,18)/t7-,8+,10-/m1/s1 |
| InChIKey | DQNXAFIQXACNPB-KHQFGBGNSA-N |
| XLogP | 1.43 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |