C11H14N6O2 — CID 178105145
6,10-dioxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine (PubChem CID 178105145) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 6,10-dioxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine.
| Compound Name | 6,10-dioxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine |
|---|---|
| PubChem CID | 178105145 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 6,10-dioxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine |
| SMILES | Nc1nc2c3c(n[nH]c3n1)OCC1COCCCN21 |
| InChI | InChI=1S/C11H14N6O2/c12-11-13-8-7-9(14-11)17-2-1-3-18-4-6(17)5-19-10(7)16-15-8/h6H,1-5H2,(H3,12,13,14,15,16) |
| InChIKey | WSMRYTUKBOTLNA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |