C12H16N6O — CID 178104978
10-oxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine (PubChem CID 178104978) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 10-oxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine.
| Compound Name | 10-oxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine |
|---|---|
| PubChem CID | 178104978 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 10-oxa-2,12,13,15,17-pentazatetracyclo[9.6.1.02,8.014,18]octadeca-1(17),11,14(18),15-tetraen-16-amine |
| SMILES | Nc1nc2c3c(n[nH]c3n1)OCC1CCCCCN21 |
| InChI | InChI=1S/C12H16N6O/c13-12-14-9-8-10(15-12)18-5-3-1-2-4-7(18)6-19-11(8)17-16-9/h7H,1-6H2,(H3,13,14,15,16,17) |
| InChIKey | YSMWHEQJYSHIQD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |