C12H16N6O4 — CID 178106309
(4S)-15-amino-4-methyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene-4,8,8-triol (PubChem CID 178106309) has the molecular formula C12H16N6O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is (4S)-15-amino-4-methyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene-4,8,8-triol.
| Compound Name | (4S)-15-amino-4-methyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene-4,8,8-triol |
|---|---|
| PubChem CID | 178106309 |
| Molecular Formula | C12H16N6O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (4S)-15-amino-4-methyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene-4,8,8-triol |
| SMILES | C[C@]1(O)CCC2N(C1)c1nc(N)nc3[nH]nc(c13)OC2(O)O |
| InChI | InChI=1S/C12H16N6O4/c1-11(19)3-2-5-12(20,21)22-9-6-7(16-17-9)14-10(13)15-8(6)18(5)4-11/h5,19-21H,2-4H2,1H3,(H3,13,14,15,16,17)/t5?,11-/m0/s1 |
| InChIKey | WSCCKUDXQRBQGO-ZOHDFZEYSA-N |
| XLogP | -1.31 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|