C9H17NO2S — CID 178107461
S-[[(2R,5R)-5-hydroxy-5-methylpiperidin-2-yl]methyl] ethanethioate (PubChem CID 178107461) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is S-[[(2R,5R)-5-hydroxy-5-methylpiperidin-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2R,5R)-5-hydroxy-5-methylpiperidin-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 178107461 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | S-[[(2R,5R)-5-hydroxy-5-methylpiperidin-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1CC[C@@](C)(O)CN1 |
| InChI | InChI=1S/C9H17NO2S/c1-7(11)13-5-8-3-4-9(2,12)6-10-8/h8,10,12H,3-6H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | RDCZBMLSRZTGHO-RKDXNWHRSA-N |
| XLogP | 0.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|