C11H12ClIN4OS — CID 178107529
6-chloro-3-iodo-4-methylsulfanyl-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine (PubChem CID 178107529) has the molecular formula C11H12ClIN4OS and a molecular weight of 410.67 g/mol. Its IUPAC name is 6-chloro-3-iodo-4-methylsulfanyl-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine.
| Compound Name | 6-chloro-3-iodo-4-methylsulfanyl-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 178107529 |
| Molecular Formula | C11H12ClIN4OS |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | 6-chloro-3-iodo-4-methylsulfanyl-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine |
| SMILES | CSc1nc(Cl)nc2c1c(I)nn2C1CCCCO1 |
| InChI | InChI=1S/C11H12ClIN4OS/c1-19-10-7-8(13)16-17(6-4-2-3-5-18-6)9(7)14-11(12)15-10/h6H,2-5H2,1H3 |
| InChIKey | XVWLQFHCUVFFAX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|