C15H17BrN4O — CID 178108167
(4S)-11-bromo-4-methylspiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-8-one (PubChem CID 178108167) has the molecular formula C15H17BrN4O and a molecular weight of 349.23 g/mol. Its IUPAC name is (4S)-11-bromo-4-methylspiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-8-one.
| Compound Name | (4S)-11-bromo-4-methylspiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-8-one |
|---|---|
| PubChem CID | 178108167 |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (4S)-11-bromo-4-methylspiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-8-one |
| SMILES | C[C@H]1CC2(CCNCC2)c2c1[nH]c1ncc(Br)nc1c2=O |
| InChI | InChI=1S/C15H17BrN4O/c1-8-6-15(2-4-17-5-3-15)10-11(8)20-14-12(13(10)21)19-9(16)7-18-14/h7-8,17H,2-6H2,1H3,(H,18,20,21)/t8-/m0/s1 |
| InChIKey | MTEVYQGCPBOBPR-QMMMGPOBSA-N |
| XLogP | 2.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |