C20H25BrN4O3 — CID 178108232
tert-butyl 11-bromo-4-methyl-8-oxospiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-1'-carboxylate (PubChem CID 178108232) has the molecular formula C20H25BrN4O3 and a molecular weight of 449.35 g/mol. Its IUPAC name is tert-butyl 11-bromo-4-methyl-8-oxospiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 11-bromo-4-methyl-8-oxospiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 178108232 |
| Molecular Formula | C20H25BrN4O3 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | tert-butyl 11-bromo-4-methyl-8-oxospiro[2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraene-6,4'-piperidine]-1'-carboxylate |
| SMILES | CC1CC2(CCN(C(=O)OC(C)(C)C)CC2)c2c1[nH]c1ncc(Br)nc1c2=O |
| InChI | InChI=1S/C20H25BrN4O3/c1-11-9-20(5-7-25(8-6-20)18(27)28-19(2,3)4)13-14(11)24-17-15(16(13)26)23-12(21)10-22-17/h10-11H,5-9H2,1-4H3,(H,22,24,26) |
| InChIKey | NLNIXCKQBRQPJH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |