C14H23F3N2O — CID 178108550
(10aR)-9-(4,4,4-trifluorobutylamino)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one (PubChem CID 178108550) has the molecular formula C14H23F3N2O and a molecular weight of 292.34 g/mol. Its IUPAC name is (10aR)-9-(4,4,4-trifluorobutylamino)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one.
| Compound Name | (10aR)-9-(4,4,4-trifluorobutylamino)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one |
|---|---|
| PubChem CID | 178108550 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (10aR)-9-(4,4,4-trifluorobutylamino)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one |
| SMILES | O=C1CCCC(NCCCC(F)(F)F)C[C@H]2CCCN12 |
| InChI | InChI=1S/C14H23F3N2O/c15-14(16,17)7-3-8-18-11-4-1-6-13(20)19-9-2-5-12(19)10-11/h11-12,18H,1-10H2/t11?,12-/m1/s1 |
| InChIKey | SAZLVMOAWBCVDM-PIJUOVFKSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|