C16H18N2O3 — CID 178111712
3-(1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-methylpropanal (PubChem CID 178111712) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-methylpropanal.
| Compound Name | 3-(1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-methylpropanal |
|---|---|
| PubChem CID | 178111712 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3-(1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-methylpropanal |
| SMILES | CC(C=O)Cc1cn(Cc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H18N2O3/c1-12(11-19)8-14-10-18(16(21)17(2)15(14)20)9-13-6-4-3-5-7-13/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | ZEFJEGFZHWNORL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|