C30H41N5O5 — CID 178113083
(2S)-1-[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]-N-butan-2-ylpyrrolidine-2-carboxamide;formic acid;3-methyl-1H-indole (PubChem CID 178113083) has the molecular formula C30H41N5O5 and a molecular weight of 551.69 g/mol. Its IUPAC name is (2S)-1-[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]-N-butan-2-ylpyrrolidine-2-carboxamide;formic acid;3-methyl-1H-indole.
| Compound Name | (2S)-1-[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]-N-butan-2-ylpyrrolidine-2-carboxamide;formic acid;3-methyl-1H-indole |
|---|---|
| PubChem CID | 178113083 |
| Molecular Formula | C30H41N5O5 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | (2S)-1-[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]-N-butan-2-ylpyrrolidine-2-carboxamide;formic acid;3-methyl-1H-indole |
| SMILES | CCC(C)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)C(N)Cc1ccccc1.Cc1c[nH]c2ccccc12.O=CO |
| InChI | InChI=1S/C20H30N4O3.C9H9N.CH2O2/c1-3-14(2)23-20(27)17-10-7-11-24(17)18(25)13-22-19(26)16(21)12-15-8-5-4-6-9-15;1-7-6-10-9-5-3-2-4-8(7)9;2-1-3/h4-6,8-9,14,16-17H,3,7,10-13,21H2,1-2H3,(H,22,26)(H,23,27);2-6,10H,1H3;1H,(H,2,3)/t14?,16?,17-;;/m0../s1 |
| InChIKey | VTURULNUDCHEBC-VEPSROSNSA-N |
| XLogP | 2.76 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|