C27H31NO5S — CID 178113329
methyl 2-[4-[[4-[2-(tert-butylsulfamoyl)-5-methylphenyl]phenyl]methoxy]phenyl]acetate (PubChem CID 178113329) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is methyl 2-[4-[[4-[2-(tert-butylsulfamoyl)-5-methylphenyl]phenyl]methoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[[4-[2-(tert-butylsulfamoyl)-5-methylphenyl]phenyl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 178113329 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | methyl 2-[4-[[4-[2-(tert-butylsulfamoyl)-5-methylphenyl]phenyl]methoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCc2ccc(-c3cc(C)ccc3S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H31NO5S/c1-19-6-15-25(34(30,31)28-27(2,3)4)24(16-19)22-11-7-21(8-12-22)18-33-23-13-9-20(10-14-23)17-26(29)32-5/h6-16,28H,17-18H2,1-5H3 |
| InChIKey | FXNOTKBCGDEZQD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |