C8H12FN — CID 178113679
(3Z)-3-ethyl-5-fluorohexa-1,3,5-trien-2-amine (PubChem CID 178113679) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is (3Z)-3-ethyl-5-fluorohexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-3-ethyl-5-fluorohexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 178113679 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (3Z)-3-ethyl-5-fluorohexa-1,3,5-trien-2-amine |
| SMILES | C=C(F)/C=C(/CC)C(=C)N |
| InChI | InChI=1S/C8H12FN/c1-4-8(7(3)10)5-6(2)9/h5H,2-4,10H2,1H3/b8-5- |
| InChIKey | UGSAILUWBKAVEP-YVMONPNESA-N |
| XLogP | 2.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|