C17H25N3O6S — CID 178113789
[1-[(2-methyl-4-nitrophenyl)sulfamoylmethyl]cyclopropyl]methyl N-tert-butylcarbamate (PubChem CID 178113789) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is [1-[(2-methyl-4-nitrophenyl)sulfamoylmethyl]cyclopropyl]methyl N-tert-butylcarbamate.
| Compound Name | [1-[(2-methyl-4-nitrophenyl)sulfamoylmethyl]cyclopropyl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 178113789 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [1-[(2-methyl-4-nitrophenyl)sulfamoylmethyl]cyclopropyl]methyl N-tert-butylcarbamate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NS(=O)(=O)CC1(COC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H25N3O6S/c1-12-9-13(20(22)23)5-6-14(12)19-27(24,25)11-17(7-8-17)10-26-15(21)18-16(2,3)4/h5-6,9,19H,7-8,10-11H2,1-4H3,(H,18,21) |
| InChIKey | MEXPUKKJUFNNCE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|