C22H18FN5O2 — CID 178115794
1-[5-[(E)-1-(8-fluoroquinolin-3-yl)oxy-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile (PubChem CID 178115794) has the molecular formula C22H18FN5O2 and a molecular weight of 403.42 g/mol. Its IUPAC name is 1-[5-[(E)-1-(8-fluoroquinolin-3-yl)oxy-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile.
| Compound Name | 1-[5-[(E)-1-(8-fluoroquinolin-3-yl)oxy-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 178115794 |
| Molecular Formula | C22H18FN5O2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-[5-[(E)-1-(8-fluoroquinolin-3-yl)oxy-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile |
| SMILES | [H]/N=C/C=C(/Oc1cnc2c(F)cccc2c1)c1[nH]cc(C(=O)N2CC(C#N)C2)c1C |
| InChI | InChI=1S/C22H18FN5O2/c1-13-17(22(29)28-11-14(8-25)12-28)10-27-20(13)19(5-6-24)30-16-7-15-3-2-4-18(23)21(15)26-9-16/h2-7,9-10,14,24,27H,11-12H2,1H3/b19-5+,24-6+ |
| InChIKey | MMCWMIUSYAWAEG-FXCMQKNWSA-N |
| XLogP | 3.68 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|