C20H18F2N4O2 — CID 178115736
1-[5-[(E)-1-(2,3-difluoro-4-methylphenoxy)-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile (PubChem CID 178115736) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[5-[(E)-1-(2,3-difluoro-4-methylphenoxy)-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile.
| Compound Name | 1-[5-[(E)-1-(2,3-difluoro-4-methylphenoxy)-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 178115736 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[5-[(E)-1-(2,3-difluoro-4-methylphenoxy)-3-iminoprop-1-enyl]-4-methyl-1H-pyrrole-3-carbonyl]azetidine-3-carbonitrile |
| SMILES | [H]/N=C/C=C(/Oc1ccc(C)c(F)c1F)c1[nH]cc(C(=O)N2CC(C#N)C2)c1C |
| InChI | InChI=1S/C20H18F2N4O2/c1-11-3-4-15(18(22)17(11)21)28-16(5-6-23)19-12(2)14(8-25-19)20(27)26-9-13(7-24)10-26/h3-6,8,13,23,25H,9-10H2,1-2H3/b16-5+,23-6+ |
| InChIKey | XTRJNMNIPNIRKP-NHWNVYNISA-N |
| XLogP | 3.57 |
| TPSA | 92.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|