C35H43ClN4O4S — CID 178117320
tert-butyl 2-[[3-(3-carbamothioylphenyl)-7-chloro-1-(oxan-4-yl)indol-6-yl]methylcarbamoyl]-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 178117320) has the molecular formula C35H43ClN4O4S and a molecular weight of 651.27 g/mol. Its IUPAC name is tert-butyl 2-[[3-(3-carbamothioylphenyl)-7-chloro-1-(oxan-4-yl)indol-6-yl]methylcarbamoyl]-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[[3-(3-carbamothioylphenyl)-7-chloro-1-(oxan-4-yl)indol-6-yl]methylcarbamoyl]-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 178117320 |
| Molecular Formula | C35H43ClN4O4S |
| Molecular Weight | 651.27 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | tert-butyl 2-[[3-(3-carbamothioylphenyl)-7-chloro-1-(oxan-4-yl)indol-6-yl]methylcarbamoyl]-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(C(=O)NCc1ccc3c(-c4cccc(C(N)=S)c4)cn(C4CCOCC4)c3c1Cl)C2 |
| InChI | InChI=1S/C35H43ClN4O4S/c1-34(2,3)44-33(42)39-13-11-35(12-14-39)18-25(19-35)32(41)38-20-24-7-8-27-28(22-5-4-6-23(17-22)31(37)45)21-40(30(27)29(24)36)26-9-15-43-16-10-26/h4-8,17,21,25-26H,9-16,18-20H2,1-3H3,(H2,37,45)(H,38,41) |
| InChIKey | HPWNJLRTGCCQKT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.27 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|