About (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate
(4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate (PubChem CID 178117788) has the molecular formula C10H14BrN3O2
and a molecular weight of 288.14 g/mol. Its IUPAC name is (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate |
| PubChem CID | 178117788 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate |
| SMILES | Cc1c(Br)cnn1OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-8-9(11)7-12-14(8)16-10(15)13-5-3-2-4-6-13/h7H,2-6H2,1H3 |
| InChIKey | JRAIRHKGNZCUKV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate?
The IUPAC name of (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate (CID 178117788) is (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate.
What is the SMILES notation for (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate?
The canonical SMILES for (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate is Cc1c(Br)cnn1OC(=O)N1CCCCC1.
What is the InChIKey of (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate?
The InChIKey is JRAIRHKGNZCUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN3O2/c1-8-9(11)7-12-14(8)16-10(15)13-5-3-2-4-6-13/h7H,2-6H2,1H3.
What are the key properties of (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate?
(4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate has a molecular weight of 288.14 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-5-methylpyrazol-1-yl) piperidine-1-carboxylate is sourced from PubChem (CID 178117788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).