C13H19F2N3O2 — CID 90101229
[3-(1,1-difluoroethyl)-2-methyl-4H-pyrimidin-6-yl] piperidine-1-carboxylate (PubChem CID 90101229) has the molecular formula C13H19F2N3O2 and a molecular weight of 287.31 g/mol. Its IUPAC name is [3-(1,1-difluoroethyl)-2-methyl-4H-pyrimidin-6-yl] piperidine-1-carboxylate.
| Compound Name | [3-(1,1-difluoroethyl)-2-methyl-4H-pyrimidin-6-yl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90101229 |
| Molecular Formula | C13H19F2N3O2 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | [3-(1,1-difluoroethyl)-2-methyl-4H-pyrimidin-6-yl] piperidine-1-carboxylate |
| SMILES | CC1=NC(OC(=O)N2CCCCC2)=CCN1C(C)(F)F |
| InChI | InChI=1S/C13H19F2N3O2/c1-10-16-11(6-9-18(10)13(2,14)15)20-12(19)17-7-4-3-5-8-17/h6H,3-5,7-9H2,1-2H3 |
| InChIKey | IPNIJWDJASZPJQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|