C15H16BrNO5 — CID 178121405
5-[(4-bromo-3-methoxy-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 178121405) has the molecular formula C15H16BrNO5 and a molecular weight of 370.20 g/mol. Its IUPAC name is 5-[(4-bromo-3-methoxy-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-bromo-3-methoxy-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 178121405 |
| Molecular Formula | C15H16BrNO5 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 5-[(4-bromo-3-methoxy-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc(NC=C2C(=O)OC(C)(C)OC2=O)cc(C)c1Br |
| InChI | InChI=1S/C15H16BrNO5/c1-8-5-9(6-11(20-4)12(8)16)17-7-10-13(18)21-15(2,3)22-14(10)19/h5-7,17H,1-4H3 |
| InChIKey | FMTSFMCNMHVXNL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|