C16H13N5 — CID 178122752
1-N-methyl-4-(2-pyridin-2-ylethynyl)-2,7-naphthyridine-1,6-diamine (PubChem CID 178122752) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-N-methyl-4-(2-pyridin-2-ylethynyl)-2,7-naphthyridine-1,6-diamine.
| Compound Name | 1-N-methyl-4-(2-pyridin-2-ylethynyl)-2,7-naphthyridine-1,6-diamine |
|---|---|
| PubChem CID | 178122752 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-N-methyl-4-(2-pyridin-2-ylethynyl)-2,7-naphthyridine-1,6-diamine |
| SMILES | CNc1ncc(C#Cc2ccccn2)c2cc(N)ncc12 |
| InChI | InChI=1S/C16H13N5/c1-18-16-14-10-20-15(17)8-13(14)11(9-21-16)5-6-12-4-2-3-7-19-12/h2-4,7-10H,1H3,(H2,17,20)(H,18,21) |
| InChIKey | WFRLVTXWNUAPGN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|