About potassium;carbanide;ethyl N-phenylcarbamate
potassium;carbanide;ethyl N-phenylcarbamate (PubChem CID 178128429) has the molecular formula C10H13KNO2-
and a molecular weight of 218.32 g/mol. Its IUPAC name is potassium;carbanide;ethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | potassium;carbanide;ethyl N-phenylcarbamate |
| PubChem CID | 178128429 |
| Molecular Formula | C10H13KNO2- |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | potassium;carbanide;ethyl N-phenylcarbamate |
| SMILES | CCOC(=O)Nc1c[c-]ccc1.[CH3-].[K+] |
| InChI | InChI=1S/C9H10NO2.CH3.K/c1-2-12-9(11)10-8-6-4-3-5-7-8;;/h3-4,6-7H,2H2,1H3,(H,10,11);1H3;/q2*-1;+1 |
| InChIKey | XNOIOUORIGKSSE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbanide;ethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbanide;ethyl N-phenylcarbamate?
The IUPAC name of potassium;carbanide;ethyl N-phenylcarbamate (CID 178128429) is potassium;carbanide;ethyl N-phenylcarbamate.
What is the SMILES notation for potassium;carbanide;ethyl N-phenylcarbamate?
The canonical SMILES for potassium;carbanide;ethyl N-phenylcarbamate is CCOC(=O)Nc1c[c-]ccc1.[CH3-].[K+].
What is the InChIKey of potassium;carbanide;ethyl N-phenylcarbamate?
The InChIKey is XNOIOUORIGKSSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10NO2.CH3.K/c1-2-12-9(11)10-8-6-4-3-5-7-8;;/h3-4,6-7H,2H2,1H3,(H,10,11);1H3;/q2*-1;+1.
What are the key properties of potassium;carbanide;ethyl N-phenylcarbamate?
potassium;carbanide;ethyl N-phenylcarbamate has a molecular weight of 218.32 g/mol, XLogP of -0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbanide;ethyl N-phenylcarbamate is sourced from PubChem (CID 178128429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).