C12H18N4O — CID 178128816
ethane;5-(1-methoxy-2-phenylethyl)-2H-tetrazole (PubChem CID 178128816) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is ethane;5-(1-methoxy-2-phenylethyl)-2H-tetrazole.
| Compound Name | ethane;5-(1-methoxy-2-phenylethyl)-2H-tetrazole |
|---|---|
| PubChem CID | 178128816 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | ethane;5-(1-methoxy-2-phenylethyl)-2H-tetrazole |
| SMILES | CC.COC(Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C10H12N4O.C2H6/c1-15-9(10-11-13-14-12-10)7-8-5-3-2-4-6-8;1-2/h2-6,9H,7H2,1H3,(H,11,12,13,14);1-2H3 |
| InChIKey | KSNCPNDTALETBC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |