C17H13N3O3 — CID 178130115
N-(4-hydroxyphenyl)-4-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 178130115) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-4-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-4-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 178130115 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(4-hydroxyphenyl)-4-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1nn(-c2ccccc2)ccc1=O |
| InChI | InChI=1S/C17H13N3O3/c21-14-8-6-12(7-9-14)18-17(23)16-15(22)10-11-20(19-16)13-4-2-1-3-5-13/h1-11,21H,(H,18,23) |
| InChIKey | WDJNWMHPBOQJML-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|