C22H22F2N4O3 — CID 178131793
5-[1-[(2-ethyl-7-fluoro-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-6-fluoropyridine-2-carboxylic acid (PubChem CID 178131793) has the molecular formula C22H22F2N4O3 and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-[1-[(2-ethyl-7-fluoro-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-6-fluoropyridine-2-carboxylic acid.
| Compound Name | 5-[1-[(2-ethyl-7-fluoro-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-6-fluoropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 178131793 |
| Molecular Formula | C22H22F2N4O3 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 5-[1-[(2-ethyl-7-fluoro-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-6-fluoropyridine-2-carboxylic acid |
| SMILES | CCc1nc2cc(F)c(CN3CCC(c4ccc(C(=O)O)nc4F)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H22F2N4O3/c1-2-16-21(29)27-18-9-13(15(23)10-19(18)25-16)11-28-7-5-12(6-8-28)14-3-4-17(22(30)31)26-20(14)24/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | LBEQFLKWMFIMAM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|